ChemNet > CAS > 24068-15-3 2-Chlormethyl-5-(4-chlorphenyl)-1,2,4-oxadiazol
24068-15-3 2-Chlormethyl-5-(4-chlorphenyl)-1,2,4-oxadiazol
| Produkt-Name |
2-Chlormethyl-5-(4-chlorphenyl)-1,2,4-oxadiazol |
| Synonyme |
2-Chlormethyl-5-(4-chlorphenyl)-1,3,4-oxadiazol |
| Englischer Name |
2-Chloromethyl-5-(4-chlorophenyl)-1,2,4-oxadiazole; 2-Chloromethyl-5-(4-chlorophenyl)-1,3,4-oxadiazole |
| Molekulare Formel |
C9H6Cl2N2O |
| Molecular Weight |
229.0627 |
| InChI |
InChI=1/C9H6Cl2N2O/c10-5-8-12-13-9(14-8)6-1-3-7(11)4-2-6/h1-4H,5H2 |
| CAS Registry Number |
24068-15-3 |
| Molecular Structure |
|
| Dichte |
1.4g/cm3 |
| Schmelzpunkt |
81℃ |
| Siedepunkt |
343.8°C at 760 mmHg |
| Brechungsindex |
1.574 |
| Flammpunkt |
161.7°C |
| Dampfdruck |
0.000136mmHg at 25°C |
| Gefahrensymbole |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|