ChemNet > CAS > 2434-49-3 Dihydro-6-methyl-2,4(1H,3H)-pyrimidinedione
2434-49-3 Dihydro-6-methyl-2,4(1H,3H)-pyrimidinedione
| Produkt-Name |
Dihydro-6-methyl-2,4(1H,3H)-pyrimidinedione |
| Englischer Name |
Dihydro-6-methyl-2,4(1H,3H)-pyrimidinedione; 2,4(1H,3H)-Pyrimidinedione, dihydro-6-methyl-; 2434-49-3; Dihydro-6-methyl-2,4(1H,3H)-pyrimidinedione; T6MVMVTJ F1; 6-methyldihydropyrimidine-2,4(1H,3H)-dione; (6S)-6-methyldihydropyrimidine-2,4(1H,3H)-dione; (6R)-6-methyldihydropyrimidine-2,4(1H,3H)-dione |
| Molekulare Formel |
C5H8N2O2 |
| Molecular Weight |
128.1292 |
| InChI |
InChI=1/C5H8N2O2/c1-3-2-4(8)7-5(9)6-3/h3H,2H2,1H3,(H2,6,7,8,9)/t3-/m1/s1 |
| CAS Registry Number |
2434-49-3 |
| EINECS |
219-421-8 |
| Molecular Structure |
|
| Dichte |
1.149g/cm3 |
| Brechungsindex |
1.452 |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
