ChemNet > CAS > 24431-27-4 (4-Ethylphenoxy)-acetic acid
24431-27-4 (4-Ethylphenoxy)-acetic acid
| Produkt-Name |
(4-Ethylphenoxy)-acetic acid |
| Englischer Name |
(4-Ethylphenoxy)-acetic acid; 4-Ethylphenoxyacetic acid |
| Molekulare Formel |
C10H12O3 |
| Molecular Weight |
180.2005 |
| InChI |
InChI=1/C10H12O3/c1-2-8-3-5-9(6-4-8)13-7-10(11)12/h3-6H,2,7H2,1H3,(H,11,12) |
| CAS Registry Number |
24431-27-4 |
| EINECS |
246-245-9 |
| Molecular Structure |
|
| Dichte |
1.144g/cm3 |
| Siedepunkt |
309.6°C at 760 mmHg |
| Brechungsindex |
1.53 |
| Flammpunkt |
121.6°C |
| Dampfdruck |
0.000272mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
