ChemNet > CAS > 24464-63-9 n-Decylboronic acid
24464-63-9 n-Decylboronic acid
| Produkt-Name |
n-Decylboronic acid |
| Englischer Name |
n-Decylboronic acid; n-Decaneboronic acid; decylboronic acid |
| Molekulare Formel |
C10H23BO2 |
| Molecular Weight |
186.0994 |
| InChI |
InChI=1/C10H23BO2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h12-13H,2-10H2,1H3 |
| CAS Registry Number |
24464-63-9 |
| Molecular Structure |
|
| Dichte |
0.883g/cm3 |
| Siedepunkt |
297.1°C at 760 mmHg |
| Brechungsindex |
1.434 |
| Flammpunkt |
133.5°C |
| Dampfdruck |
0.000141mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
