ChemNet > CAS > 2455-24-5 Tetrahydrofurfuryl methacrylate
2455-24-5 Tetrahydrofurfuryl methacrylate
| Produkt-Name |
Tetrahydrofurfuryl methacrylate |
| Englischer Name |
Tetrahydrofurfuryl methacrylate; Methacrylic acid tetrahydrofurfuryl ester; tetrahydrofuran-2-ylmethyl 2-methylprop-2-enoate |
| Molekulare Formel |
C9H14O3 |
| Molecular Weight |
170.2057 |
| InChI |
InChI=1/C9H14O3/c1-7(2)9(10)12-6-8-4-3-5-11-8/h8H,1,3-6H2,2H3 |
| CAS Registry Number |
2455-24-5 |
| EINECS |
219-529-5 |
| Molecular Structure |
|
| Dichte |
1.03g/cm3 |
| Siedepunkt |
265°C at 760 mmHg |
| Brechungsindex |
1.452 |
| Flammpunkt |
105.6°C |
| Dampfdruck |
0.0094mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S36:;
|
|
