24800-44-0 Tripropylene glycol
Produkt-Name |
Tripropylene glycol |
Englischer Name |
Tripropylene glycol; Tripropylene glycol (mixture of isomers); Tripropyleneglycol,90%; Tripropyleneglycol; TPG; 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol; 3,3'-[propane-1,2-diylbis(oxy)]dipropan-1-ol; tripropylene glycol, mixture of isomers |
Molekulare Formel |
C9H20O4 |
Molecular Weight |
192.2527 |
InChI |
InChI=1/C9H20O4/c1-9(13-7-3-5-11)8-12-6-2-4-10/h9-11H,2-8H2,1H3 |
CAS Registry Number |
24800-44-0 |
EINECS |
246-466-0 |
Molecular Structure |
|
Dichte |
1.038g/cm3 |
Siedepunkt |
316.1°C at 760 mmHg |
Brechungsindex |
1.455 |
Flammpunkt |
145°C |
Dampfdruck |
3.54E-05mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
|
|