ChemNet > CAS > 25038-36-2 Ethylene/propylene/diene terpolymer
25038-36-2 Ethylene/propylene/diene terpolymer
| Produkt-Name |
Ethylene/propylene/diene terpolymer |
| Englischer Name |
Ethylene/propylene/diene terpolymer; Poly(ethylene-co-propylene-co-5-methylene-2-norbornene); ethylene; (5E)-5-ethylidenebicyclo[2.2.1]hept-2-ene; prop-1-ene; Ethylene Propylene Diene Monomer; EPDM;
|
| Molekulare Formel |
C14H22 |
| Molecular Weight |
190.3245 |
| InChI |
InChI=1/C9H12.C3H6.C2H4/c1-2-8-5-7-3-4-9(8)6-7;1-3-2;1-2/h2-4,7,9H,5-6H2,1H3;3H,1H2,2H3;1-2H2/b8-2+;; |
| CAS Registry Number |
25038-36-2 |
| Molecular Structure |
|
| Siedepunkt |
146°C at 760 mmHg |
| Flammpunkt |
34.2°C |
| Dampfdruck |
5.98mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|