25038-87-3 Polyvinylmethylketon)
Produkt-Name |
Polyvinylmethylketon) |
Synonyme |
;P oly(Methylvinylketon); aber-3-en-2-eins |
Englischer Name |
Poly(vinyl methyl ketone); Poly(Methyl vinyl ketone); but-3-en-2-one |
Molekulare Formel |
C4H6O |
Molecular Weight |
70.0898 |
InChI |
InChI=1/C4H6O/c1-3-4(2)5/h3H,1H2,2H3 |
CAS Registry Number |
25038-87-3 |
EINECS |
201-160-6 |
Molecular Structure |
|
Dichte |
0.807g/cm3 |
Siedepunkt |
81.4°C at 760 mmHg |
Brechungsindex |
1.384 |
Dampfdruck |
82.1mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|