ChemNet > CAS > 25354-97-6 2-hexyldecanoic acid
25354-97-6 2-hexyldecanoic acid
| Produkt-Name |
2-hexyldecanoic acid |
| Englischer Name |
2-hexyldecanoic acid; Hexyldecanoicacid; 2-n-Hexyldecanoic acid |
| Molekulare Formel |
C16H32O2 |
| Molecular Weight |
256.4241 |
| InChI |
InChI=1/C16H32O2/c1-3-5-7-9-10-12-14-15(16(17)18)13-11-8-6-4-2/h15H,3-14H2,1-2H3,(H,17,18) |
| CAS Registry Number |
25354-97-6 |
| EINECS |
246-885-9 |
| Molecular Structure |
|
| Dichte |
0.891g/cm3 |
| Schmelzpunkt |
18℃ |
| Siedepunkt |
371°C at 760 mmHg |
| Brechungsindex |
1.452 |
| Flammpunkt |
207.1°C |
| Dampfdruck |
1.6E-06mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
