ChemNet > CAS > 25369-78-2 5-Chloro-2-mercaptobenzimidazole
25369-78-2 5-Chloro-2-mercaptobenzimidazole
| Produkt-Name |
5-Chloro-2-mercaptobenzimidazole |
| Englischer Name |
5-Chloro-2-mercaptobenzimidazole; 5-Chlorobenzimidazole-2-thiol; 6-chloro-1H-benzimidazole-2-thiol |
| Molekulare Formel |
C7H5ClN2S |
| Molecular Weight |
184.646 |
| InChI |
InChI=1/C7H5ClN2S/c8-4-1-2-5-6(3-4)10-7(11)9-5/h1-3H,(H2,9,10,11) |
| CAS Registry Number |
25369-78-2 |
| EINECS |
246-903-5 |
| Molecular Structure |
|
| Dichte |
1.54g/cm3 |
| Schmelzpunkt |
290-292℃ |
| Siedepunkt |
300.7°C at 760 mmHg |
| Brechungsindex |
1.75 |
| Flammpunkt |
135.6°C |
| Dampfdruck |
0.0011mmHg at 25°C |
| Gefahrensymbole |
 T:Toxic;
|
| Risk Codes |
R25:Toxic if swallowed.;
|
| Safety Beschreibung |
S28A:After contact with skin, wash immediately with plenty of water.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
