ChemNet > CAS > 26021-56-7 Benzoesäure, Verbindung mit Morpolin (1:1)
26021-56-7 Benzoesäure, Verbindung mit Morpolin (1:1)
| Produkt-Name |
Benzoesäure, Verbindung mit Morpolin (1:1) |
| Synonyme |
Morpholin, Benzoat (1:1); Benzoesäure, Verbindung mit Morpholin (1:1); Morpholin, Benzoat; Morpholinbenzoat (1:1) |
| Englischer Name |
benzoic acid, compound with morpholine (1:1);Morpholine, benzoate (1:1); Benzoic acid, compound with morpholine (1:1); Morpholine, benzoate; morpholine benzoate (1:1) |
| Molekulare Formel |
C11H15NO3 |
| Molecular Weight |
209.2417 |
| InChI |
InChI=1/C7H6O2.C4H9NO/c8-7(9)6-4-2-1-3-5-6;1-3-6-4-2-5-1/h1-5H,(H,8,9);5H,1-4H2 |
| CAS Registry Number |
26021-56-7 |
| EINECS |
247-413-4 |
| Molecular Structure |
|
| Siedepunkt |
249.3°C at 760 mmHg |
| Flammpunkt |
111.4°C |
| Dampfdruck |
0.0122mmHg at 25°C |
|