26260-02-6 2-Iodobenzaldehyde
Produkt-Name |
2-Iodobenzaldehyde |
Englischer Name |
2-Iodobenzaldehyde; Benzaldehyde, 2-iodo- |
Molekulare Formel |
C7H5IO |
Molecular Weight |
232.0185 |
InChI |
InChI=1/C7H5IO/c8-7-4-2-1-3-6(7)5-9/h1-5H |
CAS Registry Number |
26260-02-6 |
Molecular Structure |
|
Dichte |
1.883g/cm3 |
Schmelzpunkt |
36-39℃ |
Siedepunkt |
266.3°C at 760 mmHg |
Brechungsindex |
1.668 |
Flammpunkt |
114.8°C |
Dampfdruck |
0.00873mmHg at 25°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|