ChemNet > CAS > 26663-77-4 methyl 1H-benzimidazole-5-carboxylate
26663-77-4 methyl 1H-benzimidazole-5-carboxylate
Produkt-Name |
methyl 1H-benzimidazole-5-carboxylate |
Englischer Name |
methyl 1H-benzimidazole-5-carboxylate; 1H-Benzimidazole-5-carboxylic acid methyl ester; methyl 1H-benzimidazole-6-carboxylate |
Molekulare Formel |
C9H8N2O2 |
Molecular Weight |
176.172 |
InChI |
InChI=1/C9H8N2O2/c1-13-9(12)6-2-3-7-8(4-6)11-5-10-7/h2-5H,1H3,(H,10,11) |
CAS Registry Number |
26663-77-4 |
Molecular Structure |
|
Dichte |
1.324g/cm3 |
Siedepunkt |
416.2°C at 760 mmHg |
Brechungsindex |
1.648 |
Flammpunkt |
205.5°C |
Dampfdruck |
3.9E-07mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|