ChemNet > CAS > 2683-90-1 8-Azahypoxanthine
2683-90-1 8-Azahypoxanthine
| Produkt-Name |
8-Azahypoxanthine |
| Englischer Name |
8-Azahypoxanthine; 4,5-dihydro-1H-triazolo(4,5-d)pyrimidin-4-ol; 2,3-dihydro-7H-[1,2,3]triazolo[4,5-d]pyrimidin-7-one; 3,7a-dihydro-7H-[1,2,3]triazolo[4,5-d]pyrimidin-7-one |
| Molekulare Formel |
C4H3N5O |
| Molecular Weight |
137.0995 |
| InChI |
InChI=1/C4H3N5O/c10-4-2-3(5-1-6-4)8-9-7-2/h1-2H,(H,5,6,7,8,10) |
| CAS Registry Number |
2683-90-1 |
| EINECS |
220-244-3 |
| Molecular Structure |
|
| Dichte |
2.26g/cm3 |
| Siedepunkt |
233.8°C at 760 mmHg |
| Brechungsindex |
2.087 |
| Flammpunkt |
95.2°C |
| Dampfdruck |
0.0548mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
