2693-46-1 3-Aminofluoranthene
Produkt-Name |
3-Aminofluoranthene |
Englischer Name |
3-Aminofluoranthene; 3-Fluoranthenamine; fluoranthen-3-ylamine; fluoranthen-3-amine |
Molekulare Formel |
C16H11N |
Molecular Weight |
217.2652 |
InChI |
InChI=1/C16H11N/c17-15-9-8-13-11-5-2-1-4-10(11)12-6-3-7-14(15)16(12)13/h1-9H,17H2 |
CAS Registry Number |
2693-46-1 |
EINECS |
220-263-7 |
Molecular Structure |
|
Dichte |
1.322g/cm3 |
Schmelzpunkt |
115-117℃ |
Siedepunkt |
440.8°C at 760 mmHg |
Brechungsindex |
1.904 |
Flammpunkt |
246.2°C |
Dampfdruck |
5.71E-08mmHg at 25°C |
Gefahrensymbole |
Xn:Harmful;
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|