ChemNet > CAS > 2700-22-3 Benzylidenemalononitrile
2700-22-3 Benzylidenemalononitrile
| Produkt-Name |
Benzylidenemalononitrile |
| Englischer Name |
Benzylidenemalononitrile; beta,beta-styrenedicarbonitrile; Benzalmalononitrile; 2-benzylidenemalononitrile; benzylidenepropanedinitrile |
| Molekulare Formel |
C10H6N2 |
| Molecular Weight |
154.168 |
| InChI |
InChI=1/C10H6N2/c11-7-10(8-12)6-9-4-2-1-3-5-9/h1-6H |
| CAS Registry Number |
2700-22-3 |
| EINECS |
220-283-6 |
| Molecular Structure |
|
| Dichte |
1.154g/cm3 |
| Schmelzpunkt |
82-86℃ |
| Siedepunkt |
294.8°C at 760 mmHg |
| Brechungsindex |
1.612 |
| Flammpunkt |
138°C |
| Dampfdruck |
0.00159mmHg at 25°C |
| Gefahrensymbole |
 T:Toxic;
|
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
