28469-92-3 2,6-Dichlorostyrene
Produkt-Name |
2,6-Dichlorostyrene |
Englischer Name |
2,6-Dichlorostyrene; Benzene, 1,3-dichloro-2-ethenyl-; 1,3-dichloro-2-ethenylbenzene |
Molekulare Formel |
C8H6Cl2 |
Molecular Weight |
173.0392 |
InChI |
InChI=1/C8H6Cl2/c1-2-6-7(9)4-3-5-8(6)10/h2-5H,1H2 |
CAS Registry Number |
28469-92-3 |
EINECS |
249-039-7 |
Molecular Structure |
|
Dichte |
1.242g/cm3 |
Siedepunkt |
222.4°C at 760 mmHg |
Brechungsindex |
1.589 |
Flammpunkt |
93.9°C |
Dampfdruck |
0.151mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|