286-99-7 Cyclododecane epoxide
Produkt-Name |
Cyclododecane epoxide |
Englischer Name |
Cyclododecane epoxide; Cyclododecane epoxide, mixture of cis andtrans isomers; Cyclododecene oxide (cis+trans); Cyclododecane oxide; Epoxy N-Dodecane; 13-oxabicyclo[10.1.0]tridecane; (1R,12R)-13-oxabicyclo[10.1.0]tridecane; (1R,12S)-13-oxabicyclo[10.1.0]tridecane; (1S,12S)-13-oxabicyclo[10.1.0]tridecane |
Molekulare Formel |
C12H22O |
Molecular Weight |
182.3025 |
InChI |
InChI=1/C12H22O/c1-2-4-6-8-10-12-11(13-12)9-7-5-3-1/h11-12H,1-10H2/t11-,12-/m0/s1 |
CAS Registry Number |
286-99-7 |
EINECS |
206-012-4 |
Molecular Structure |
|
Dichte |
0.899g/cm3 |
Schmelzpunkt |
-7℃ |
Siedepunkt |
237.4°C at 760 mmHg |
Brechungsindex |
1.455 |
Flammpunkt |
82.2°C |
Dampfdruck |
0.0691mmHg at 25°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R38:;
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|