ChemNet > CAS > 288246-16-2 4-bromo-1H-pyrazole-3-carbonitrile
288246-16-2 4-bromo-1H-pyrazole-3-carbonitrile
| Produkt-Name |
4-bromo-1H-pyrazole-3-carbonitrile |
| Englischer Name |
4-bromo-1H-pyrazole-3-carbonitrile; 4-Bromo-3-cyano-1H-pyrazole; 4-bromo-1H-pyrazole-5-carbonitrile; 4-Bromo-2H-pyrazole-3-carbonitrile |
| Molekulare Formel |
C4H2BrN3 |
| Molecular Weight |
171.9828 |
| InChI |
InChI=1/C4H2BrN3/c5-3-2-7-8-4(3)1-6/h2H,(H,7,8) |
| CAS Registry Number |
288246-16-2 |
| Molecular Structure |
|
| Dichte |
2.01g/cm3 |
| Schmelzpunkt |
158℃ |
| Siedepunkt |
412.4°C at 760 mmHg |
| Brechungsindex |
1.639 |
| Flammpunkt |
203.2°C |
| Dampfdruck |
5.18E-07mmHg at 25°C |
| Gefahrensymbole |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
