ChemNet > CAS > 300395-93-1 1-(4-methoxyphenyl)-2-(2-methyl-4-nitro-1H-imidazol-1-yl)ethan-1-on
300395-93-1 1-(4-methoxyphenyl)-2-(2-methyl-4-nitro-1H-imidazol-1-yl)ethan-1-on
| Produkt-Name |
1-(4-methoxyphenyl)-2-(2-methyl-4-nitro-1H-imidazol-1-yl)ethan-1-on |
| Synonyme |
1-(4-Methoxyphenyl)-2-(2-methyl-4-nitro-1H-imidazol-1-yl)ethanon |
| Englischer Name |
1-(4-methoxyphenyl)-2-(2-methyl-4-nitro-1H-imidazol-1-yl)ethan-1-one;1-(4-methoxyphenyl)-2-(2-methyl-4-nitro-1H-imidazol-1-yl)ethanone |
| Molekulare Formel |
C13H13N3O4 |
| Molecular Weight |
275.26 |
| InChI |
InChI=1/C13H13N3O4/c1-9-14-13(16(18)19)8-15(9)7-12(17)10-3-5-11(20-2)6-4-10/h3-6,8H,7H2,1-2H3 |
| CAS Registry Number |
300395-93-1 |
| Molecular Structure |
|
| Dichte |
1.32g/cm3 |
| Schmelzpunkt |
250℃ |
| Siedepunkt |
527.9°C at 760 mmHg |
| Brechungsindex |
1.608 |
| Flammpunkt |
273.1°C |
| Dampfdruck |
3.12E-11mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
