30273-11-1 4-sec-Butylaniline
Produkt-Name |
4-sec-Butylaniline |
Englischer Name |
4-sec-Butylaniline; benzenamine, 4-(1-methylpropyl)-; p-sec-Butylaniline; 4-(butan-2-yl)aniline; N-(1-methylpropyl)-benzenamine |
Molekulare Formel |
C10H15N |
Molecular Weight |
149.2328 |
InChI |
InChI=1/C10H15N/c1-3-8(2)9-4-6-10(11)7-5-9/h4-8H,3,11H2,1-2H3 |
CAS Registry Number |
30273-11-1 |
EINECS |
250-108-9 |
Molecular Structure |
|
Dichte |
0.942g/cm3 |
Siedepunkt |
244.2°C at 760 mmHg |
Brechungsindex |
1.535 |
Flammpunkt |
107.8°C |
Dampfdruck |
0.0308mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Beschreibung |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|