ChemNet > CAS > 30273-11-1 4-sec-Butylaniline
30273-11-1 4-sec-Butylaniline
| Produkt-Name |
4-sec-Butylaniline |
| Englischer Name |
4-sec-Butylaniline; benzenamine, 4-(1-methylpropyl)-; p-sec-Butylaniline; 4-(butan-2-yl)aniline; N-(1-methylpropyl)-benzenamine |
| Molekulare Formel |
C10H15N |
| Molecular Weight |
149.2328 |
| InChI |
InChI=1/C10H15N/c1-3-8(2)9-4-6-10(11)7-5-9/h4-8H,3,11H2,1-2H3 |
| CAS Registry Number |
30273-11-1 |
| EINECS |
250-108-9 |
| Molecular Structure |
|
| Dichte |
0.942g/cm3 |
| Siedepunkt |
244.2°C at 760 mmHg |
| Brechungsindex |
1.535 |
| Flammpunkt |
107.8°C |
| Dampfdruck |
0.0308mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
