3033-82-7 8-Chloroquinaldine
Produkt-Name |
8-Chloroquinaldine |
Englischer Name |
8-Chloroquinaldine; 8-Chloro-2-methylquinoline; 2-Methyl-8-chloroquinoline |
Molekulare Formel |
C10H8ClN |
Molecular Weight |
177.6302 |
InChI |
InChI=1/C10H8ClN/c1-7-5-6-8-3-2-4-9(11)10(8)12-7/h2-6H,1H3 |
CAS Registry Number |
3033-82-7 |
Molecular Structure |
|
Dichte |
1.225g/cm3 |
Schmelzpunkt |
64-66℃ |
Siedepunkt |
278.2°C at 760 mmHg |
Brechungsindex |
1.634 |
Flammpunkt |
148.7°C |
Dampfdruck |
0.00732mmHg at 25°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|