3034-19-3 2-Nitrophenylhydrazine
Produkt-Name |
2-Nitrophenylhydrazine |
Englischer Name |
2-Nitrophenylhydrazine; BRN 0512797; Hydrazine, (o-nitrophenyl)- |
Molekulare Formel |
C6H7N3O2 |
Molecular Weight |
153.1387 |
InChI |
InChI=1/C6H7N3O2/c7-8-5-3-1-2-4-6(5)9(10)11/h1-4,8H,7H2 |
CAS Registry Number |
3034-19-3 |
EINECS |
221-222-6 |
Molecular Structure |
|
Dichte |
1.419g/cm3 |
Schmelzpunkt |
89-94℃ |
Siedepunkt |
314.3°C at 760 mmHg |
Brechungsindex |
1.691 |
Flammpunkt |
143.9°C |
Dampfdruck |
0.000469mmHg at 25°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R5:Heating may cause an explosion.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|