ChemNet > CAS > 306934-87-2 6-fluoro-4H-1,3-benzodioxine-8-carbaldehyde
306934-87-2 6-fluoro-4H-1,3-benzodioxine-8-carbaldehyde
| Produkt-Name |
6-fluoro-4H-1,3-benzodioxine-8-carbaldehyde |
| Englischer Name |
6-fluoro-4H-1,3-benzodioxine-8-carbaldehyde; 6-Fluoro-1,3-benzodioxene-8-carbaldehyde |
| Molekulare Formel |
C9H7FO3 |
| Molecular Weight |
182.1485 |
| InChI |
InChI=1/C9H7FO3/c10-8-1-6(3-11)9-7(2-8)4-12-5-13-9/h1-3H,4-5H2 |
| CAS Registry Number |
306934-87-2 |
| Molecular Structure |
|
| Dichte |
1.357g/cm3 |
| Schmelzpunkt |
116℃ |
| Siedepunkt |
323.051°C at 760 mmHg |
| Brechungsindex |
1.566 |
| Flammpunkt |
144.319°C |
| Dampfdruck |
0mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
