ChemNet > CAS > 3085-42-5 4-Chlorophenyl sulfoxide
3085-42-5 4-Chlorophenyl sulfoxide
Produkt-Name |
4-Chlorophenyl sulfoxide |
Englischer Name |
4-Chlorophenyl sulfoxide; Bis(4-chlorophenyl) sulfoxide; 4-Chlorophenyl sulphoxide~4,4-Dichlorodiphenyl sulphoxide; 4,4-Dichlorodiphenyl sulfoxide; 1,1'-sulfinylbis(4-chlorobenzene) |
Molekulare Formel |
C12H8Cl2OS |
Molecular Weight |
271.1623 |
InChI |
InChI=1/C12H8Cl2OS/c13-9-1-5-11(6-2-9)16(15)12-7-3-10(14)4-8-12/h1-8H |
CAS Registry Number |
3085-42-5 |
EINECS |
221-397-9 |
Molecular Structure |
|
Dichte |
1.48g/cm3 |
Schmelzpunkt |
140-145℃ |
Siedepunkt |
406.2°C at 760 mmHg |
Brechungsindex |
1.689 |
Flammpunkt |
199.5°C |
Dampfdruck |
1.94E-06mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|