ChemNet > CAS > 3086-62-2 3,4,5-Trimethoxybenzamide
3086-62-2 3,4,5-Trimethoxybenzamide
| Produkt-Name |
3,4,5-Trimethoxybenzamide |
| Englischer Name |
3,4,5-Trimethoxybenzamide;4-10-00-02020 (Beilstein Handbook Reference); AI3-23424; BRN 2697325; NSC 16947; Benzamide, 3,4,5-trimethoxy- |
| Molekulare Formel |
C10H13NO4 |
| Molecular Weight |
211.2145 |
| InChI |
InChI=1/C10H13NO4/c1-13-7-4-6(10(11)12)5-8(14-2)9(7)15-3/h4-5H,1-3H3,(H2,11,12) |
| CAS Registry Number |
3086-62-2 |
| EINECS |
221-406-6 |
| Molecular Structure |
|
| Dichte |
1.172g/cm3 |
| Siedepunkt |
275.4°C at 760 mmHg |
| Brechungsindex |
1.525 |
| Flammpunkt |
104.2°C |
| Dampfdruck |
0.0051mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
