ChemNet > CAS > 3096-52-4 2-nitro-9-fluorenone
3096-52-4 2-nitro-9-fluorenone
| Produkt-Name |
2-nitro-9-fluorenone |
| Englischer Name |
2-nitro-9-fluorenone;2-Nitro-9-fluorenone; 4-07-00-01636 (Beilstein Handbook Reference); BRN 2052959; CCRIS 2540; NSC 12365; 9H-Fluoren-9-one, 2-nitro-; 2-nitro-9H-fluoren-9-one |
| Molekulare Formel |
C13H7NO3 |
| Molecular Weight |
225.1996 |
| InChI |
InChI=1/C13H7NO3/c15-13-11-4-2-1-3-9(11)10-6-5-8(14(16)17)7-12(10)13/h1-7H |
| CAS Registry Number |
3096-52-4 |
| Molecular Structure |
|
| Dichte |
1.437g/cm3 |
| Schmelzpunkt |
222-223℃ |
| Siedepunkt |
419°C at 760 mmHg |
| Brechungsindex |
1.698 |
| Flammpunkt |
215.1°C |
| Dampfdruck |
3.13E-07mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
