3096-57-9 2-Amino-9-fluorenone
Produkt-Name |
2-Amino-9-fluorenone |
Englischer Name |
2-Amino-9-fluorenone; Aminofluorenone; 2-amino-9H-fluoren-9-one |
Molekulare Formel |
C13H9NO |
Molecular Weight |
195.2167 |
InChI |
InChI=1/C13H9NO/c14-8-5-6-10-9-3-1-2-4-11(9)13(15)12(10)7-8/h1-7H,14H2 |
CAS Registry Number |
3096-57-9 |
EINECS |
221-445-9 |
Molecular Structure |
|
Dichte |
1.327g/cm3 |
Schmelzpunkt |
152-157℃ |
Siedepunkt |
426.4°C at 760 mmHg |
Brechungsindex |
1.72 |
Flammpunkt |
211.7°C |
Dampfdruck |
1.77E-07mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|