31252-42-3 4-Benzylpiperidine
Produkt-Name |
4-Benzylpiperidine |
Englischer Name |
4-Benzylpiperidine; 4-(Phenylmethyl)piperidine; 4-benzylpiperidinium; 4-Benzyl piperidine |
Molekulare Formel |
C12H18N |
Molecular Weight |
176.2775 |
InChI |
InChI=1/C12H17N/c1-2-4-11(5-3-1)10-12-6-8-13-9-7-12/h1-5,12-13H,6-10H2/p+1 |
CAS Registry Number |
31252-42-3 |
EINECS |
250-535-0 |
Molecular Structure |
|
Schmelzpunkt |
6-7℃ |
Siedepunkt |
279.6°C at 760 mmHg |
Flammpunkt |
125.4°C |
Dampfdruck |
0.00397mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|