31366-25-3 Tetrathiafulvalene
Produkt-Name |
Tetrathiafulvalene |
Englischer Name |
Tetrathiafulvalene; delta2,2-Bi-1,3-dithiole; TTF; TetrathiafulvaleneTTForangextl; delta-2:2-bis(1,3-dithiazole); DELTA^2^,^2^-Bi-1,3-dithiole~TTF; 2-(1,3-dithiol-2-ylidene)-1,3-dithiole |
Molekulare Formel |
C6H4S4 |
Molecular Weight |
204.356 |
InChI |
InChI=1/C6H4S4/c1-2-8-5(7-1)6-9-3-4-10-6/h1-4H |
CAS Registry Number |
31366-25-3 |
EINECS |
250-593-7 |
Molecular Structure |
|
Dichte |
1.636g/cm3 |
Schmelzpunkt |
117-120℃ |
Siedepunkt |
229°C at 760 mmHg |
Brechungsindex |
1.879 |
Flammpunkt |
120.9°C |
Dampfdruck |
0.107mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|