3160-35-8 4-Hydroxybenzal Acetone
Produkt-Name |
4-Hydroxybenzal Acetone |
Englischer Name |
4-Hydroxybenzal Acetone; 4-Hydroxybenzylidenacetone; 4-Hydroxybenzylideneacetone; 4-(4-hydroxyphenyl)but-3-en-2-one; (3E)-4-(4-hydroxyphenyl)but-3-en-2-one |
Molekulare Formel |
C10H10O2 |
Molecular Weight |
162.1852 |
InChI |
InChI=1/C10H10O2/c1-8(11)2-3-9-4-6-10(12)7-5-9/h2-7,12H,1H3/b3-2+ |
CAS Registry Number |
3160-35-8 |
EINECS |
221-607-9 |
Molecular Structure |
|
Dichte |
1.138g/cm3 |
Siedepunkt |
318.1°C at 760 mmHg |
Brechungsindex |
1.599 |
Flammpunkt |
134.8°C |
Dampfdruck |
0.000198mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|