ChemNet > CAS > 31872-61-4 4-Methoxy-3-nitropyridine hydrochloride
31872-61-4 4-Methoxy-3-nitropyridine hydrochloride
| Produkt-Name |
4-Methoxy-3-nitropyridine hydrochloride |
| Englischer Name |
4-Methoxy-3-nitropyridine hydrochloride; 3-Nitro-4-methoxypyridine hydrochloride; 4-methoxy-3-nitropyridine hydrochloride (1:1) |
| Molekulare Formel |
C6H7N2O3Cl |
| Molecular Weight |
190.5861 |
| InChI |
InChI:1S/C6H6N2O3.ClH/c1-11-6-2-3-7-4-5(6)8(9)10;/h2-4H,1H3;1H |
| CAS Registry Number |
31872-61-4 |
| Molecular Structure |
|
| Dichte |
1.3g/cm3 |
| Siedepunkt |
275.9°C at 760 mmHg |
| Brechungsindex |
1.546 |
| Flammpunkt |
120.7°C |
| Dampfdruck |
0.00834mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
