ChemNet > CAS > 31874-34-7 2,4-Dimethoxybenzaldoxime
31874-34-7 2,4-Dimethoxybenzaldoxime
| Produkt-Name |
2,4-Dimethoxybenzaldoxime |
| Englischer Name |
2,4-Dimethoxybenzaldoxime;1-(2,4-dimethoxyphenyl)-N-hydroxymethanimine; 2,4-dimethoxybenzaldehyde oxime |
| Molekulare Formel |
C9H11NO3 |
| Molecular Weight |
181.1885 |
| InChI |
InChI=1/C9H11NO3/c1-12-8-4-3-7(6-10-11)9(5-8)13-2/h3-6,11H,1-2H3/b10-6+ |
| CAS Registry Number |
31874-34-7 |
| Molecular Structure |
|
| Dichte |
1.11g/cm3 |
| Siedepunkt |
304.9°C at 760 mmHg |
| Brechungsindex |
1.501 |
| Flammpunkt |
138.2°C |
| Dampfdruck |
0.000372mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
