32556-70-0 (R)-1-Octyn-3-ol
Produkt-Name |
(R)-1-Octyn-3-ol |
Englischer Name |
(R)-1-Octyn-3-ol; (R)-(+)-1-Octyn-3-ol; (3R)-oct-1-yn-3-ol |
Molekulare Formel |
C8H14O |
Molecular Weight |
126.1962 |
InChI |
InChI=1/C8H14O/c1-3-5-6-7-8(9)4-2/h2,8-9H,3,5-7H2,1H3/t8-/m0/s1 |
CAS Registry Number |
32556-70-0 |
Molecular Structure |
|
Dichte |
0.887g/cm3 |
Siedepunkt |
169.6°C at 760 mmHg |
Brechungsindex |
1.452 |
Flammpunkt |
63.9°C |
Dampfdruck |
0.496mmHg at 25°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|