ChemNet > CAS > 3261-87-8 Thiodiglycolic anhydride
3261-87-8 Thiodiglycolic anhydride
| Produkt-Name |
Thiodiglycolic anhydride |
| Englischer Name |
Thiodiglycolic anhydride; 1,4-Oxathiane-2,6-dione; 2,2-Thiodiacetic acid anhydride; 1,4-oxathiane-2,6-dione |
| Molekulare Formel |
C4H4O3S |
| Molecular Weight |
132.1378 |
| InChI |
InChI=1/C4H4O3S/c5-3-1-8-2-4(6)7-3/h1-2H2 |
| CAS Registry Number |
3261-87-8 |
| Molecular Structure |
|
| Dichte |
1.468g/cm3 |
| Schmelzpunkt |
93-94℃ |
| Siedepunkt |
341.8°C at 760 mmHg |
| Brechungsindex |
1.545 |
| Flammpunkt |
190.5°C |
| Dampfdruck |
7.86E-05mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
