| Produkt-Name |
Diethylthiodicarbonat |
| Synonyme |
Thiodicarbonsäure ((HO)C(O)SC(S)(OH)), OC,OC'-Diethylester; AI3-19742; Ethylxanthogen-Ethylformiat; NSC-403191; Xanthsäure, Ethyl-, Anhydrosulfid mit O-Ethylthiocarbonat; Xanthsäure, Ethyl-, Anhydrosulfid mit O-Ethylthiolcarbonat; Kohlensäure, Dithio-, Anhydrosulfid mit O-Ethylthiocarbonat, O-Ethylester (8CI); Diethylthiodicarbonat ((OH)C(O)SC(S)(OH)); Thiodicarbonsäure ((HO)C(O)SC(S)(OH)), Diethylester; Thiodicarbonsäure, Diethylester; O,O-Diethyldithiodicarbonat |
| Englischer Name |
diethyl thiodicarbonate;Thiodicarbonic acid ((HO)C(O)SC(S)(OH)), OC,OC'-diethyl ester; AI3-19742; Ethyl xanthogen ethyl formate; NSC 403191; Xanthic acid, ethyl-, anhydrosulfide with O-ethyl thiocarbonate; Xanthic acid, ethyl-, anhydrosulfide with O-ethyl thiolcarbonate; Carbonic acid, dithio-, anhydrosulfide with O-ethyl thiocarbonate, O-ethyl ester (8CI); Diethyl thiodicarbonate ((OH)C(O)SC(S)(OH)); Thiodicarbonic acid ((HO)C(O)SC(S)(OH)), diethyl ester; Thiodicarbonic acid, diethyl ester; O,O-diethyl dithiodicarbonate |
| Molekulare Formel |
C6H10O3S2 |
| Molecular Weight |
194.2718 |
| InChI |
InChI=1/C6H10O3S2/c1-3-8-5(7)11-6(10)9-4-2/h3-4H2,1-2H3 |
| CAS Registry Number |
3278-35-1 |
| EINECS |
221-911-1 |
| Molecular Structure |
|
| Dichte |
1.242g/cm3 |
| Siedepunkt |
236°C at 760 mmHg |
| Brechungsindex |
1.534 |
| Flammpunkt |
96.5°C |
| Dampfdruck |
0.0487mmHg at 25°C |
|