ChemNet > CAS > 32852-81-6 3-Phenoxyphenylacetic acid
32852-81-6 3-Phenoxyphenylacetic acid
| Produkt-Name |
3-Phenoxyphenylacetic acid |
| Englischer Name |
3-Phenoxyphenylacetic acid; 3-Phenoxyphenylacetic |
| Molekulare Formel |
C14H12O3 |
| Molecular Weight |
228.2433 |
| InChI |
InChI=1/C14H12O3/c15-14(16)10-11-5-4-8-13(9-11)17-12-6-2-1-3-7-12/h1-9H,10H2,(H,15,16) |
| CAS Registry Number |
32852-81-6 |
| Molecular Structure |
|
| Dichte |
1.217g/cm3 |
| Siedepunkt |
385.4°C at 760 mmHg |
| Brechungsindex |
1.596 |
| Flammpunkt |
147.4°C |
| Dampfdruck |
1.25E-06mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
