ChemNet > CAS > 32863-31-3 5-(bromomethyl)-2,1,3-benzoxadiazole
32863-31-3 5-(bromomethyl)-2,1,3-benzoxadiazole
| Produkt-Name |
5-(bromomethyl)-2,1,3-benzoxadiazole |
| Englischer Name |
5-(bromomethyl)-2,1,3-benzoxadiazole; |
| Molekulare Formel |
C7H5BrN2O |
| Molecular Weight |
213.0314 |
| InChI |
InChI=1/C7H5BrN2O/c8-4-5-1-2-6-7(3-5)10-11-9-6/h1-3H,4H2 |
| CAS Registry Number |
32863-31-3 |
| Molecular Structure |
|
| Dichte |
1.742g/cm3 |
| Siedepunkt |
283.5°C at 760 mmHg |
| Brechungsindex |
1.661 |
| Flammpunkt |
125.3°C |
| Dampfdruck |
0.00538mmHg at 25°C |
| Gefahrensymbole |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
