33155-90-7 Hydroxybenzoquinoline
Produkt-Name |
Hydroxybenzoquinoline |
Englischer Name |
Hydroxybenzoquinoline; 10-Hydroxybenzo[h]quinoline; benzo[h]quinolin-10-ol |
Molekulare Formel |
C13H9NO |
Molecular Weight |
195.2167 |
InChI |
InChI=1/C13H9NO/c15-11-5-1-3-9-6-7-10-4-2-8-14-13(10)12(9)11/h1-8,15H |
CAS Registry Number |
33155-90-7 |
Molecular Structure |
|
Dichte |
1.307g/cm3 |
Siedepunkt |
420.621°C at 760 mmHg |
Brechungsindex |
1.768 |
Flammpunkt |
208.184°C |
Dampfdruck |
0mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|