ChemNet > CAS > 3320-90-9 2,5-diethoxytetrahydrofuran, mixture of isom
3320-90-9 2,5-diethoxytetrahydrofuran, mixture of isom
| Produkt-Name |
2,5-diethoxytetrahydrofuran, mixture of isom |
| Englischer Name |
2,5-diethoxytetrahydrofuran, mixture of isom; 2,5-diethoxytetrahydrofuran |
| Molekulare Formel |
C8H16O3 |
| Molecular Weight |
160.2108 |
| InChI |
InChI=1/C8H16O3/c1-3-9-7-5-6-8(11-7)10-4-2/h7-8H,3-6H2,1-2H3 |
| CAS Registry Number |
3320-90-9 |
| EINECS |
222-026-3 |
| Molecular Structure |
|
| Dichte |
0.98g/cm3 |
| Siedepunkt |
173.1°C at 760 mmHg |
| Brechungsindex |
1.432 |
| Flammpunkt |
56.7°C |
| Dampfdruck |
1.72mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
|
|
