ChemNet > CAS > 33524-31-1 2,5-Dimethoxybenzyl alcohol
33524-31-1 2,5-Dimethoxybenzyl alcohol
Produkt-Name |
2,5-Dimethoxybenzyl alcohol |
Englischer Name |
2,5-Dimethoxybenzyl alcohol;(2,5-dimethoxyphenyl)methanol |
Molekulare Formel |
C9H12O3 |
Molecular Weight |
168.1898 |
InChI |
InChI=1/C9H12O3/c1-11-8-3-4-9(12-2)7(5-8)6-10/h3-5,10H,6H2,1-2H3 |
CAS Registry Number |
33524-31-1 |
EINECS |
251-562-0 |
Molecular Structure |
|
Dichte |
1.111g/cm3 |
Siedepunkt |
305.6°C at 760 mmHg |
Brechungsindex |
1.521 |
Flammpunkt |
127.7°C |
Dampfdruck |
0.000354mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|