33775-94-9 2-Iodothioanisole
Produkt-Name |
2-Iodothioanisole |
Englischer Name |
2-Iodothioanisole; 2-Iodophenyl methyl sulphide~2-(Methylthio)iodobenzene; 1-Iodo-2-(methylthio)benzene; 1-iodo-2-(methylsulfanyl)benzene |
Molekulare Formel |
C7H7IS |
Molecular Weight |
250.0999 |
InChI |
InChI=1/C7H7IS/c1-9-7-5-3-2-4-6(7)8/h2-5H,1H3 |
CAS Registry Number |
33775-94-9 |
Molecular Structure |
|
Dichte |
1.78g/cm3 |
Siedepunkt |
253°C at 760 mmHg |
Brechungsindex |
1.67 |
Flammpunkt |
106.8°C |
Dampfdruck |
0.0298mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|