33892-75-0 5-methoxy-1-tetralone
Produkt-Name |
5-methoxy-1-tetralone |
Englischer Name |
5-methoxy-1-tetralone; 5-methoxy-1,2,3,4-tetrahydronaphthalen-1-one; 5-Methoxy-3,4-dihydro-2H-naphthalen-1-one |
Molekulare Formel |
C7H8BrN |
Molecular Weight |
186.0491 |
InChI |
InChI=1/C7H8BrN/c1-6-3-2-4-7(5-8)9-6/h2-4H,5H2,1H3 |
CAS Registry Number |
33892-75-0 |
EINECS |
251-723-5 |
Molecular Structure |
|
Dichte |
1.449g/cm3 |
Schmelzpunkt |
87-91℃ |
Siedepunkt |
209.865°C at 760 mmHg |
Brechungsindex |
1.565 |
Flammpunkt |
80.724°C |
Dampfdruck |
0.287mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|