33898-90-7 2-Thenoylacetonitrile
Produkt-Name |
2-Thenoylacetonitrile |
Englischer Name |
2-Thenoylacetonitrile; 3-Oxo-3-(2-thienyl)propionitrile; 3-Oxo-3-(2-thienyl)propanenitrile; 3-oxo-3-(thiophen-2-yl)propanenitrile |
Molekulare Formel |
C7H5NOS |
Molecular Weight |
151.1857 |
InChI |
InChI=1/C7H5NOS/c8-4-3-6(9)7-2-1-5-10-7/h1-2,5H,3H2 |
CAS Registry Number |
33898-90-7 |
Molecular Structure |
|
Dichte |
1.256g/cm3 |
Schmelzpunkt |
128-134℃ |
Siedepunkt |
338.3°C at 760 mmHg |
Brechungsindex |
1.565 |
Flammpunkt |
158.4°C |
Dampfdruck |
9.88E-05mmHg at 25°C |
Gefahrensymbole |
Xn:Harmful;
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Beschreibung |
S36/37:Wear suitable protective clothing and gloves.;
|
|