ChemNet > CAS > 33974-27-5 phenyl(4-pyridyl)methanol
33974-27-5 phenyl(4-pyridyl)methanol
| Produkt-Name |
phenyl(4-pyridyl)methanol |
| Englischer Name |
phenyl(4-pyridyl)methanol;alpha-Phenylpyridine-4-methanol; phenyl(pyridin-4-yl)methanol |
| Molekulare Formel |
C12H11NO |
| Molecular Weight |
185.2218 |
| InChI |
InChI=1/C12H11NO/c14-12(10-4-2-1-3-5-10)11-6-8-13-9-7-11/h1-9,12,14H |
| CAS Registry Number |
33974-27-5 |
| EINECS |
251-770-1 |
| Molecular Structure |
|
| Dichte |
1.155g/cm3 |
| Schmelzpunkt |
120℃ |
| Siedepunkt |
353.5°C at 760 mmHg |
| Brechungsindex |
1.604 |
| Flammpunkt |
167.6°C |
| Dampfdruck |
1.32E-05mmHg at 25°C |
| Gefahrensymbole |
 Xn:Harmful;
|
| Risk Codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
