ChemNet > CAS > 34490-86-3 Dimethyl suberimidate dihydrochloride
34490-86-3 Dimethyl suberimidate dihydrochloride
| Produkt-Name |
Dimethyl suberimidate dihydrochloride |
| Englischer Name |
Dimethyl suberimidate dihydrochloride; Suberimidic acid dimethyl ester dihydrochloride; dimethyl (1Z,8Z)-octanebis(imidoate); dimethyl (1Z,8Z)-octanebis(imidoate) dihydrochloride; dimethyl octanebis(imidoate) |
| Molekulare Formel |
C10H20N2O2 |
| Molecular Weight |
200.278 |
| InChI |
InChI=1/C10H20N2O2/c1-13-9(11)7-5-3-4-6-8-10(12)14-2/h11-12H,3-8H2,1-2H3 |
| CAS Registry Number |
34490-86-3 |
| EINECS |
252-060-4 |
| Molecular Structure |
|
| Dichte |
1.01g/cm3 |
| Schmelzpunkt |
213-216℃ |
| Siedepunkt |
247.437°C at 760 mmHg |
| Brechungsindex |
1.465 |
| Flammpunkt |
103.447°C |
| Dampfdruck |
0.04mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
