ChemNet > CAS > 3469-26-9 2,7-Dimethoxynaphthalene
3469-26-9 2,7-Dimethoxynaphthalene
| Produkt-Name |
2,7-Dimethoxynaphthalene |
| Englischer Name |
2,7-Dimethoxynaphthalene; 2,7-dimethoxyl Naphthalene |
| Molekulare Formel |
C12H12O2 |
| Molecular Weight |
188.2225 |
| InChI |
InChI=1/C12H12O2/c1-13-11-5-3-9-4-6-12(14-2)8-10(9)7-11/h3-8H,1-2H3 |
| CAS Registry Number |
3469-26-9 |
| EINECS |
222-433-6 |
| Molecular Structure |
|
| Dichte |
1.097g/cm3 |
| Schmelzpunkt |
137-139℃ |
| Siedepunkt |
311.2°C at 760 mmHg |
| Brechungsindex |
1.584 |
| Flammpunkt |
130.3°C |
| Dampfdruck |
0.00105mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
