35354-37-1 1-Bromo-5-methylhexane
Produkt-Name |
1-Bromo-5-methylhexane |
Englischer Name |
1-Bromo-5-methylhexane; |
Molekulare Formel |
C7H15Br |
Molecular Weight |
179.098 |
InChI |
InChI=1/C7H15Br/c1-7(2)5-3-4-6-8/h7H,3-6H2,1-2H3 |
CAS Registry Number |
35354-37-1 |
Molecular Structure |
|
Dichte |
1.136g/cm3 |
Siedepunkt |
168°C at 760 mmHg |
Brechungsindex |
1.447 |
Flammpunkt |
48.4°C |
Dampfdruck |
2.18mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|