ChemNet > CAS > 35364-79-5 3,4-Dichlorophenethylalcohol
35364-79-5 3,4-Dichlorophenethylalcohol
Produkt-Name |
3,4-Dichlorophenethylalcohol |
Englischer Name |
3,4-Dichlorophenethylalcohol; 2-(3,4-dichlorophenyl)ethanol; 3,4-Dichlorophenethyl alcohol |
Molekulare Formel |
C8H8Cl2O |
Molecular Weight |
191.0545 |
InChI |
InChI=1/C8H8Cl2O/c9-7-2-1-6(3-4-11)5-8(7)10/h1-2,5,11H,3-4H2 |
CAS Registry Number |
35364-79-5 |
Molecular Structure |
|
Dichte |
1.329g/cm3 |
Siedepunkt |
279.1°C at 760 mmHg |
Brechungsindex |
1.569 |
Flammpunkt |
117.9°C |
Dampfdruck |
0.00196mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|