3558-69-8 2,6-Diphenylpyridine
Produkt-Name |
2,6-Diphenylpyridine |
Englischer Name |
2,6-Diphenylpyridine; Diphenylpyridine |
Molekulare Formel |
C17H13N |
Molecular Weight |
231.2918 |
InChI |
InChI=1/C17H13N/c1-3-8-14(9-4-1)16-12-7-13-17(18-16)15-10-5-2-6-11-15/h1-13H |
CAS Registry Number |
3558-69-8 |
EINECS |
222-620-2 |
Molecular Structure |
|
Dichte |
1.084g/cm3 |
Schmelzpunkt |
73-77℃ |
Siedepunkt |
397°C at 760 mmHg |
Brechungsindex |
1.605 |
Flammpunkt |
166.4°C |
Dampfdruck |
3.75E-06mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|